| MolName | (Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine |
| MolecularFormula | C17H19N3OCl2 |
| Smiles | N/N=C\C(CC/C1=C\c(ccc(Cl)c2)c2Cl)=C1N1CCOCC1 |
| InChI | InChI=1S/C17H19Cl2N3O/c18-15-4-3-12(16(19)10-15)9-13-1-2-14(11-21-20)17(13)22-5-7-23-8-6-22/h3-4,9-11H,1-2,5-8,20H2 |
| InChIK | NDOOCJACSVVAFT-UHFFFAOYSA-N |
| TotalMolweight | 352.264 |
| Molweight | 352.264 |
| MonoisotopicMass | 351.090516 |
| CLogP | 3.3583 |
| CLogS | -4.431 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 260.87 |
| Relative PSA | 0.1546 |
| PolarSurfaceArea | 50.85 |
| Druglikeness | -0.064953 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine | 2 - (Z)-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]methylidenehydrazine