| MolName | N-[(Z)-3-phenylpropylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C16H16N4 |
| Smiles | C(Cc1ccccc1)/C=N\Nc1nc(cccc2)c2[nH]1 |
| InChI | InChI=1S/C16H16N4/c1-2-7-13(8-3-1)9-6-12-17-20-16-18-14-10-4-5-11-15(14)19-16/h1-5,7-8,10-12H,6,9H2,(H2,18,19,20) |
| InChIK | NDQGQIWPGMQPNJ-UHFFFAOYSA-N |
| TotalMolweight | 264.331 |
| Molweight | 264.331 |
| MonoisotopicMass | 264.137496 |
| CLogP | 4.9516 |
| CLogS | -3.788 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 219.69 |
| Relative PSA | 0.21817 |
| PolarSurfaceArea | 53.07 |
| Druglikeness | 2.017 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-phenylpropylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-3-phenylpropylideneamino]-1H-benzimidazol-2-amine