| MolName | 4-(benzenesulfonamido)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C20H15N3O3Cl2S |
| Smiles | O=C(c(cc1)ccc1NS(c1ccccc1)(=O)=O)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C20H15Cl2N3O3S/c21-18-7-4-8-19(22)17(18)13-23-24-20(26)14-9-11-15(12-10-14)25-29(27,28)16-5-2-1-3-6-16/h1-13,25H,(H,24,26) |
| InChIK | NDRYDKCKRLRTRT-UHFFFAOYSA-N |
| TotalMolweight | 448.329 |
| Molweight | 448.329 |
| MonoisotopicMass | 447.021116 |
| CLogP | 4.7127 |
| CLogS | -6.526 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 317.63 |
| Relative PSA | 0.23943 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | -0.31988 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(benzenesulfonamido)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide | 2 - 4-(benzenesulfonamido)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]benzamide