| MolName | [4-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| MolecularFormula | C21H20N4O4S3 |
| Smiles | CC(Oc(ccc(/C=N\NC(CSc1nnc(SCc2ccccc2)s1)=O)c1)c1OC)=O |
| InChI | InChI=1S/C21H20N4O4S3/c1-14(26)29-17-9-8-16(10-18(17)28-2)11-22-23-19(27)13-31-21-25-24-20(32-21)30-12-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H,23,27) |
| InChIK | NDVDBJFWYZRAPO-UHFFFAOYSA-N |
| TotalMolweight | 488.612 |
| Molweight | 488.612 |
| MonoisotopicMass | 488.064666 |
| CLogP | 4.3297 |
| CLogS | -6.658 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 364.98 |
| Relative PSA | 0.40093 |
| PolarSurfaceArea | 181.61 |
| Druglikeness | 4.7173 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate | 2 - [4-[(Z)-[[2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate