| MolName | N-(4-fluorophenyl)-2-[4-[(Z)-[(2-phenylsulfanylacetyl)hydrazinylidene]methyl]phenoxy]acetamide |
| MolecularFormula | C23H20N3O3FS |
| Smiles | O=C(COc1ccc(/C=N\NC(CSc2ccccc2)=O)cc1)Nc(cc1)ccc1F |
| InChI | InChI=1S/C23H20FN3O3S/c24-18-8-10-19(11-9-18)26-22(28)15-30-20-12-6-17(7-13-20)14-25-27-23(29)16-31-21-4-2-1-3-5-21/h1-14H,15-16H2,(H,26,28)(H,27,29) |
| InChIK | NDZWEMVWFMZCAX-UHFFFAOYSA-N |
| TotalMolweight | 437.494 |
| Molweight | 437.494 |
| MonoisotopicMass | 437.12094 |
| CLogP | 4.2376 |
| CLogS | -5.869 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 337.32 |
| Relative PSA | 0.26088 |
| PolarSurfaceArea | 105.09 |
| Druglikeness | 3.7421 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.74194 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-fluorophenyl)-2-[4-[(Z)-[(2-phenylsulfanylacetyl)hydrazinylidene]methyl]phenoxy]acetamide | 2 - N-(4-fluorophenyl)-2-[4-[(Z)-[(2-phenylsulfanylacetyl)hydrazinylidene]methyl]phenoxy]acetamide