| MolName | 4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C24H18N5O3S |
| Smiles | [O-]C(c1ccc(/C=N\NC(CSc2nnc(-c3ccccc3)n2-c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C24H19N5O3S/c30-21(26-25-15-17-11-13-19(14-12-17)23(31)32)16-33-24-28-27-22(18-7-3-1-4-8-18)29(24)20-9-5-2-6-10-20/h1-15H,16H2,(H,26,30)(H,31,32)/p-1 |
| InChIK | NEIXPMLTFKDTRB-UHFFFAOYSA-M |
| TotalMolweight | 456.505 |
| Molweight | 456.505 |
| MonoisotopicMass | 456.113035 |
| CLogP | 1.9409 |
| CLogS | -8.429 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 349.76 |
| Relative PSA | 0.31344 |
| PolarSurfaceArea | 137.6 |
| Druglikeness | 5.455 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate