| MolName | N-[(Z)-[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C24H26N7O2ClS |
| Smiles | Clc(cc1)ccc1Sc1c(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cccc1 |
| InChI | InChI=1S/C24H26ClN7O2S/c25-19-5-7-20(8-6-19)35-21-4-2-1-3-18(21)17-26-30-22-27-23(31-9-13-33-14-10-31)29-24(28-22)32-11-15-34-16-12-32/h1-8,17H,9-16H2,(H,27,28,29,30) |
| InChIK | NEPRUSJTWYFKOO-UHFFFAOYSA-N |
| TotalMolweight | 512.036 |
| Molweight | 512.036 |
| MonoisotopicMass | 511.15572 |
| CLogP | 6.0276 |
| CLogS | -6.063 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 381.87 |
| Relative PSA | 0.2631 |
| PolarSurfaceArea | 113.3 |
| Druglikeness | 3.5315 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-[2-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine