| MolName | (Z)-1-[3,5-dichloro-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C20H18N4O2Cl2 |
| Smiles | C=CCc(cccc1)c1OCCOc(c(Cl)cc(/C=N\n1cnnc1)c1)c1Cl |
| InChI | InChI=1S/C20H18Cl2N4O2/c1-2-5-16-6-3-4-7-19(16)27-8-9-28-20-17(21)10-15(11-18(20)22)12-25-26-13-23-24-14-26/h2-4,6-7,10-14H,1,5,8-9H2 |
| InChIK | NFBTUCXQMIQGSW-UHFFFAOYSA-N |
| TotalMolweight | 417.295 |
| Molweight | 417.295 |
| MonoisotopicMass | 416.08068 |
| CLogP | 4.8237 |
| CLogS | -7.762 |
| H Acceptors | 6 |
| TotalSurfaceArea | 320.92 |
| Relative PSA | 0.18796 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -6.6229 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,5-dichloro-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3,5-dichloro-4-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine