| MolName | 4-amino-N'-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C14H12N6O |
| Smiles | N/C(/c1nonc1N)=N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C14H12N6O/c15-13(12-14(16)20-21-19-12)18-17-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H,(H2,15,18)(H2,16,20) |
| InChIK | NFIOFVQEQLYSNI-UHFFFAOYSA-N |
| TotalMolweight | 280.29 |
| Molweight | 280.29 |
| MonoisotopicMass | 280.107259 |
| CLogP | 3.3734 |
| CLogS | -4.371 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 219.6 |
| Relative PSA | 0.40806 |
| PolarSurfaceArea | 115.68 |
| Druglikeness | 2.5525 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,5-oxadiazole-3-carboximidamide