| MolName | 2-[(2-chlorophenyl)methoxy]-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C22H17N2O3ClF2 |
| Smiles | O=C(c(cccc1)c1OCc(cccc1)c1Cl)N/N=C\c(cccc1)c1OC(F)F |
| InChI | InChI=1S/C22H17ClF2N2O3/c23-18-10-4-1-8-16(18)14-29-20-12-6-3-9-17(20)21(28)27-26-13-15-7-2-5-11-19(15)30-22(24)25/h1-13,22H,14H2,(H,27,28) |
| InChIK | NFKVAUORMUJENM-UHFFFAOYSA-N |
| TotalMolweight | 430.837 |
| Molweight | 430.837 |
| MonoisotopicMass | 430.089576 |
| CLogP | 5.3251 |
| CLogS | -6.42 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 321.13 |
| Relative PSA | 0.17442 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 1.2667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-chlorophenyl)methoxy]-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzamide | 2 - 2-[(2-chlorophenyl)methoxy]-N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzamide