| MolName | 2-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| MolecularFormula | C18H15N3O3ClF3S |
| Smiles | O=C(CSCC(N/N=C\c(cc1)ccc1Cl)=O)Nc(cc1)ccc1OC(F)(F)F |
| InChI | InChI=1S/C18H15ClF3N3O3S/c19-13-3-1-12(2-4-13)9-23-25-17(27)11-29-10-16(26)24-14-5-7-15(8-6-14)28-18(20,21)22/h1-9H,10-11H2,(H,24,26)(H,25,27) |
| InChIK | NFLHLJVYQSFHCB-UHFFFAOYSA-N |
| TotalMolweight | 445.848 |
| Molweight | 445.848 |
| MonoisotopicMass | 445.047473 |
| CLogP | 4.4951 |
| CLogS | -5.891 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 316.09 |
| Relative PSA | 0.2784 |
| PolarSurfaceArea | 105.09 |
| Druglikeness | -2.9227 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide | 2 - 2-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide