| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[4-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]phenyl]sulfonylaniline |
| MolecularFormula | C26H20N4O2Cl2S |
| Smiles | O=S(c(cc1)ccc1N/N=C\c(cccc1)c1Cl)(c(cc1)ccc1N/N=C\c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C26H20Cl2N4O2S/c27-25-7-3-1-5-19(25)17-29-31-21-9-13-23(14-10-21)35(33,34)24-15-11-22(12-16-24)32-30-18-20-6-2-4-8-26(20)28/h1-18,31-32H |
| InChIK | NFNZTEAXFRAONI-UHFFFAOYSA-N |
| TotalMolweight | 523.443 |
| Molweight | 523.443 |
| MonoisotopicMass | 522.0684 |
| CLogP | 9.9394 |
| CLogS | -7.69 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 384.4 |
| Relative PSA | 0.19386 |
| PolarSurfaceArea | 91.3 |
| Druglikeness | 2.7518 |
| Mutagenic | none |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[4-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]phenyl]sulfonylaniline | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[4-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]phenyl]sulfonylaniline