| MolName | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C12H11N7O5 |
| Smiles | [O-][N+](c1cc(/C=N\NC(CNC(C(N2)=O)=NNC2=O)=O)ccc1)=O |
| InChI | InChI=1S/C12H11N7O5/c20-9(6-13-10-11(21)15-12(22)18-17-10)16-14-5-7-2-1-3-8(4-7)19(23)24/h1-5H,6H2,(H,13,17)(H,16,20)(H2,15,18,21,22) |
| InChIK | NFQQYWVXXRSFQG-UHFFFAOYSA-N |
| TotalMolweight | 333.263 |
| Molweight | 333.263 |
| MonoisotopicMass | 333.082168 |
| CLogP | -1.577 |
| CLogS | -3.396 |
| H Acceptors | 12 |
| H Donors | 4 |
| TotalSurfaceArea | 244.01 |
| Relative PSA | 0.56719 |
| PolarSurfaceArea | 169.87 |
| Druglikeness | 1.7549 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide | 2 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide