| MolName | 4-N-(4-chlorophenyl)-2-N-[(Z)-(3-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H19N7OClI |
| Smiles | Clc(cc1)ccc1Nc1nc(N/N=C\c2cccc(I)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H19ClIN7O/c21-15-4-6-17(7-5-15)24-18-25-19(27-20(26-18)29-8-10-30-11-9-29)28-23-13-14-2-1-3-16(22)12-14/h1-7,12-13H,8-11H2,(H2,24,25,26,27,28) |
| InChIK | NGBZLGRUFHBLBI-UHFFFAOYSA-N |
| TotalMolweight | 535.772 |
| Molweight | 535.772 |
| MonoisotopicMass | 535.038433 |
| CLogP | 6.505 |
| CLogS | -6.768 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 340.28 |
| Relative PSA | 0.23772 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 3.8602 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-chlorophenyl)-2-N-[(Z)-(3-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-chlorophenyl)-2-N-[(Z)-(3-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine