| MolName | (Z)-1-(5-morpholin-4-ylthiophen-2-yl)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]methanimine |
| MolecularFormula | C18H22N4O2S2 |
| Smiles | C(COCC1)N1c1ccc(/C=N\N=C/c2ccc(N3CCOCC3)s2)s1 |
| InChI | InChI=1S/C18H22N4O2S2/c1-3-17(21-5-9-23-10-6-21)25-15(1)13-19-20-14-16-2-4-18(26-16)22-7-11-24-12-8-22/h1-4,13-14H,5-12H2 |
| InChIK | NHCWCFNEHVQVTL-UHFFFAOYSA-N |
| TotalMolweight | 390.531 |
| Molweight | 390.531 |
| MonoisotopicMass | 390.118416 |
| CLogP | 4.236 |
| CLogS | -4.658 |
| H Acceptors | 6 |
| TotalSurfaceArea | 298.1 |
| Relative PSA | 0.30473 |
| PolarSurfaceArea | 106.14 |
| Druglikeness | 4.3232 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 10 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-morpholin-4-ylthiophen-2-yl)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]methanimine | 2 - (Z)-1-(5-morpholin-4-ylthiophen-2-yl)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]methanimine