| MolName | 2-pyrrol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C16H13N3OS |
| Smiles | O=C(c(cccc1)c1-n1cccc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C16H13N3OS/c20-16(18-17-12-13-6-5-11-21-13)14-7-1-2-8-15(14)19-9-3-4-10-19/h1-12H,(H,18,20) |
| InChIK | NHCYTOCOOFBVJY-UHFFFAOYSA-N |
| TotalMolweight | 295.365 |
| Molweight | 295.365 |
| MonoisotopicMass | 295.077932 |
| CLogP | 3.2531 |
| CLogS | -6.044 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 231.89 |
| Relative PSA | 0.27272 |
| PolarSurfaceArea | 74.63 |
| Druglikeness | 6.513 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-pyrrol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 2-pyrrol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide