| MolName | [4-bromo-2-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C27H20N3O4Br |
| Smiles | O=C(CNC(c1cccc2ccccc12)=O)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C27H20BrN3O4/c28-21-13-14-24(35-27(34)19-8-2-1-3-9-19)20(15-21)16-30-31-25(32)17-29-26(33)23-12-6-10-18-7-4-5-11-22(18)23/h1-16H,17H2,(H,29,33)(H,31,32) |
| InChIK | NHHAGYBYFFJAIF-UHFFFAOYSA-N |
| TotalMolweight | 530.377 |
| Molweight | 530.377 |
| MonoisotopicMass | 529.063718 |
| CLogP | 5.6354 |
| CLogS | -7.398 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 370.7 |
| Relative PSA | 0.22538 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 3.2631 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[[2-(naphthalene-1-carbonylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate