| MolName | 4-(4-nitrophenyl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C15H11N5O2S |
| Smiles | [O-][N+](c(cc1)ccc1-c1csc(N/N=C\c2ncccc2)n1)=O |
| InChI | InChI=1S/C15H11N5O2S/c21-20(22)13-6-4-11(5-7-13)14-10-23-15(18-14)19-17-9-12-3-1-2-8-16-12/h1-10H,(H,18,19) |
| InChIK | NHHVMACQCDMBTB-UHFFFAOYSA-N |
| TotalMolweight | 325.351 |
| Molweight | 325.351 |
| MonoisotopicMass | 325.063345 |
| CLogP | 4.1775 |
| CLogS | -4.349 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 246.13 |
| Relative PSA | 0.38878 |
| PolarSurfaceArea | 124.23 |
| Druglikeness | -1.2848 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-nitrophenyl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-amine | 2 - 4-(4-nitrophenyl)-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-amine