| MolName | N,N'-bis[(Z)-2-phenylethylideneamino]oxamide |
| MolecularFormula | C18H18N4O2 |
| Smiles | O=C(C(N/N=C\Cc1ccccc1)=O)N/N=C\Cc1ccccc1 |
| InChI | InChI=1S/C18H18N4O2/c23-17(21-19-13-11-15-7-3-1-4-8-15)18(24)22-20-14-12-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2,(H,21,23)(H,22,24) |
| InChIK | NHJQVOLNTYCXRA-UHFFFAOYSA-N |
| TotalMolweight | 322.367 |
| Molweight | 322.367 |
| MonoisotopicMass | 322.142976 |
| CLogP | 1.9128 |
| CLogS | -3.892 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 268.48 |
| Relative PSA | 0.26825 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 3.2081 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-2-phenylethylideneamino]oxamide | 2 - N,N'-bis[(Z)-2-phenylethylideneamino]oxamide