| MolName | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H18N4OCl2S |
| Smiles | O=C(CSc1nc(cccc2)c2n1Cc1ccccc1)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H18Cl2N4OS/c24-18-10-6-9-17(22(18)25)13-26-28-21(30)15-31-23-27-19-11-4-5-12-20(19)29(23)14-16-7-2-1-3-8-16/h1-13H,14-15H2,(H,28,30) |
| InChIK | NHOXOSUCNIZNCS-UHFFFAOYSA-N |
| TotalMolweight | 469.395 |
| Molweight | 469.395 |
| MonoisotopicMass | 468.057835 |
| CLogP | 5.9584 |
| CLogS | -6.168 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 345.16 |
| Relative PSA | 0.20669 |
| PolarSurfaceArea | 84.58 |
| Druglikeness | 6.2732 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide | 2 - 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide