| MolName | 2-[2-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]phenoxy]acetate |
| MolecularFormula | C17H11N2O5 |
| Smiles | [O-]C(COc1c(/C=N\N(C(c2c3cccc2)=O)C3=O)cccc1)=O |
| InChI | InChI=1S/C17H12N2O5/c20-15(21)10-24-14-8-4-1-5-11(14)9-18-19-16(22)12-6-2-3-7-13(12)17(19)23/h1-9H,10H2,(H,20,21)/p-1 |
| InChIK | NHQDMVUEDHXIPG-UHFFFAOYSA-M |
| TotalMolweight | 323.283 |
| Molweight | 323.283 |
| MonoisotopicMass | 323.066798 |
| CLogP | -0.3643 |
| CLogS | -3.375 |
| H Acceptors | 7 |
| TotalSurfaceArea | 239.12 |
| Relative PSA | 0.32812 |
| PolarSurfaceArea | 99.1 |
| Druglikeness | 3.6369 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]phenoxy]acetate | 2 - 2-[2-[(Z)-(1,3-dioxoisoindol-2-yl)iminomethyl]phenoxy]acetate