| MolName | 3-(5-methyl-1H-pyrazol-3-yl)-4-[[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C14H11N6F3S |
| Smiles | Cc1cc(C(N2N=Cc3ccc(C(F)(F)F)cc3)=NNC2=S)n[nH]1 |
| InChI | InChI=1S/C14H11F3N6S/c1-8-6-11(20-19-8)12-21-22-13(24)23(12)18-7-9-2-4-10(5-3-9)14(15,16)17/h2-7H,1H3,(H,19,20)(H,22,24) |
| InChIK | NHVROELRFKHAOZ-UHFFFAOYSA-N |
| TotalMolweight | 352.343 |
| Molweight | 352.343 |
| MonoisotopicMass | 352.071798 |
| CLogP | 2.4888 |
| CLogS | -4.194 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 251.77 |
| Relative PSA | 0.3614 |
| PolarSurfaceArea | 100.76 |
| Druglikeness | -3.2463 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(5-methyl-1H-pyrazol-3-yl)-4-[[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(5-methyl-1H-pyrazol-3-yl)-4-[[4-(trifluoromethyl)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione