| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| MolecularFormula | C22H15N3O2Cl2 |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C22H15Cl2N3O2/c23-15-10-9-14(18(24)11-15)12-25-26-21(28)13-27-19-7-3-1-5-16(19)22(29)17-6-2-4-8-20(17)27/h1-12H,13H2,(H,26,28) |
| InChIK | NHWNYFRCKOVCTC-UHFFFAOYSA-N |
| TotalMolweight | 424.286 |
| Molweight | 424.286 |
| MonoisotopicMass | 423.054131 |
| CLogP | 5.5199 |
| CLogS | -8.025 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 305.9 |
| Relative PSA | 0.17195 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 6.2787 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide