| MolName | 2,6-bis(azepan-1-yl)-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine |
| MolecularFormula | C24H31N7O4 |
| Smiles | [O-][N+](c1c2OCOc2cc(/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)c2)c1)=O |
| InChI | InChI=1S/C24H31N7O4/c32-31(33)19-13-18(14-20-23(19)35-17-34-20)16-25-28-21-15-22(29-9-5-1-2-6-10-29)27-24(26-21)30-11-7-3-4-8-12-30/h13-16H,1-12,17H2,(H,26,27,28) |
| InChIK | NINRXMNTQOCOBU-UHFFFAOYSA-N |
| TotalMolweight | 481.555 |
| Molweight | 481.555 |
| MonoisotopicMass | 481.243753 |
| CLogP | 5.549 |
| CLogS | -7.161 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 369.41 |
| Relative PSA | 0.27728 |
| PolarSurfaceArea | 120.93 |
| Druglikeness | -5.2479 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 16 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-bis(azepan-1-yl)-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine | 2 - 2,6-bis(azepan-1-yl)-N-[(Z)-(7-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-4-amine