| MolName | N-[(Z)-thiophen-2-ylmethylideneamino]-2H-tetrazol-5-amine |
| MolecularFormula | C6H6N6S |
| Smiles | C(c1cccs1)=N\Nc1n[nH]nn1 |
| InChI | InChI=1S/C6H6N6S/c1-2-5(13-3-1)4-7-8-6-9-11-12-10-6/h1-4H,(H2,8,9,10,11,12) |
| InChIK | NIZZEDMYCBGIND-UHFFFAOYSA-N |
| TotalMolweight | 194.222 |
| Molweight | 194.222 |
| MonoisotopicMass | 194.037464 |
| CLogP | 2.7004 |
| CLogS | -2.567 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 151.03 |
| Relative PSA | 0.59743 |
| PolarSurfaceArea | 107.09 |
| Druglikeness | 0.1785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-2-ylmethylideneamino]-2H-tetrazol-5-amine | 2 - N-[(Z)-thiophen-2-ylmethylideneamino]-2H-tetrazol-5-amine