| MolName | 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H20N3O3Cl3S |
| Smiles | O=C(CN(CCc1ccccc1)S(c(cc1)ccc1Cl)(=O)=O)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H20Cl3N3O3S/c24-19-9-11-20(12-10-19)33(31,32)29(14-13-17-5-2-1-3-6-17)16-22(30)28-27-15-18-7-4-8-21(25)23(18)26/h1-12,15H,13-14,16H2,(H,28,30) |
| InChIK | NJHKTZIQMPRUQN-UHFFFAOYSA-N |
| TotalMolweight | 524.855 |
| Molweight | 524.855 |
| MonoisotopicMass | 523.029093 |
| CLogP | 5.7313 |
| CLogS | -6.265 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 373.17 |
| Relative PSA | 0.1826 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | 7.9581 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]acetamide