| MolName | (Z)-1-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C20H19N4O2Br |
| Smiles | C=CCc(cccc1)c1OCCOc(cc1)c(/C=N\n2cnnc2)cc1Br |
| InChI | InChI=1S/C20H19BrN4O2/c1-2-5-16-6-3-4-7-19(16)26-10-11-27-20-9-8-18(21)12-17(20)13-24-25-14-22-23-15-25/h2-4,6-9,12-15H,1,5,10-11H2 |
| InChIK | NKBNIGHHZIHGKB-UHFFFAOYSA-N |
| TotalMolweight | 427.301 |
| Molweight | 427.301 |
| MonoisotopicMass | 426.069137 |
| CLogP | 4.3369 |
| CLogS | -7.124 |
| H Acceptors | 6 |
| TotalSurfaceArea | 308.71 |
| Relative PSA | 0.19539 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -8.4421 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-bromo-2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine