| MolName | 2-[4-[(Z)-[[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C17H18N5O6S |
| Smiles | [O-]C(COc1ccc(/C=N\NC(COc2nsnc2N2CCOCC2)=O)cc1)=O |
| InChI | InChI=1S/C17H19N5O6S/c23-14(10-28-17-16(20-29-21-17)22-5-7-26-8-6-22)19-18-9-12-1-3-13(4-2-12)27-11-15(24)25/h1-4,9H,5-8,10-11H2,(H,19,23)(H,24,25)/p-1 |
| InChIK | NKMFLVCSDVWVGW-UHFFFAOYSA-M |
| TotalMolweight | 420.425 |
| Molweight | 420.425 |
| MonoisotopicMass | 420.09778 |
| CLogP | -0.7905 |
| CLogS | 0.317 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 315.09 |
| Relative PSA | 0.44172 |
| PolarSurfaceArea | 166.54 |
| Druglikeness | 5.5687 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[4-[(Z)-[[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]acetyl]hydrazinylidene]methyl]phenoxy]acetate