| MolName | N-[(Z)-[4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C34H48N14 |
| Smiles | C(CC1)CCN1c1nc(N/N=C\c2ccc(/C=N\Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C34H48N14/c1-5-17-45(18-6-1)31-37-29(38-32(41-31)46-19-7-2-8-20-46)43-35-25-27-13-15-28(16-14-27)26-36-44-30-39-33(47-21-9-3-10-22-47)42-34(40-30)48-23-11-4-12-24-48/h13-16,25-26H,1-12,17-24H2,(H,37,38,41,43)(H,39,40,42,44) |
| InChIK | NKXSKKUFSLEQKH-UHFFFAOYSA-N |
| TotalMolweight | 652.853 |
| Molweight | 652.853 |
| MonoisotopicMass | 652.418636 |
| CLogP | 10.197 |
| CLogS | -9.022 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 520.18 |
| Relative PSA | 0.24215 |
| PolarSurfaceArea | 139.08 |
| Druglikeness | 2.872 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 48 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 20 |
| Symmetricatoms | 35 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine