| MolName | 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-phenylurea |
| MolecularFormula | C24H26N4O2 |
| Smiles | O=C(Nc1ccccc1)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1 |
| InChI | InChI=1S/C24H26N4O2/c29-24(26-22-9-5-2-6-10-22)27-25-18-21-12-11-20(17-19-7-3-1-4-8-19)23(21)28-13-15-30-16-14-28/h1-10,17-18H,11-16H2,(H2,26,27,29) |
| InChIK | NLHOZWNVTBMAIH-UHFFFAOYSA-N |
| TotalMolweight | 402.496 |
| Molweight | 402.496 |
| MonoisotopicMass | 402.205576 |
| CLogP | 3.775 |
| CLogS | -4.803 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 321.94 |
| Relative PSA | 0.18954 |
| PolarSurfaceArea | 65.96 |
| Druglikeness | 4.3589 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-phenylurea | 2 - 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-phenylurea