| MolName | 1-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-5-[(Z)-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]hydrazinylidene]methyl]-1,3-diazinane-2,4,6-trione |
| MolecularFormula | C19H13N7O3Cl2F6 |
| Smiles | O=C(C(/C=N\Nc(ncc(C(F)(F)F)c1)c1Cl)C(N1CCNc2ncc(C(F)(F)F)cc2Cl)=O)NC1=O |
| InChI | InChI=1S/C19H13Cl2F6N7O3/c20-11-3-8(18(22,23)24)5-29-13(11)28-1-2-34-16(36)10(15(35)32-17(34)37)7-31-33-14-12(21)4-9(6-30-14)19(25,26)27/h3-7,10H,1-2H2,(H,28,29)(H,30,33)(H,32,35,37)/t10-/m0/s1 |
| InChIK | NLKRJZJBGDXLTD-JTQLQIEISA-N |
| TotalMolweight | 572.252 |
| Molweight | 572.252 |
| MonoisotopicMass | 571.03611 |
| CLogP | 4.0429 |
| CLogS | -5.505 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 369.51 |
| Relative PSA | 0.29904 |
| PolarSurfaceArea | 128.68 |
| Druglikeness | 0.476 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| StereoCenters | 1 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 1-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-5-[(Z)-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]hydrazinylidene]methyl]-1,3-diazinane-2,4,6-trione | 2 - 1-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-5-[(Z)-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]hydrazinylidene]methyl]-1,3-diazinane-2,4,6-trione