| MolName | (Z)-1-(1-chloro-3,4-dihydronaphthalen-2-yl)-N-[4-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]piperazin-1-yl]methanimine |
| MolecularFormula | C26H26N4Cl2 |
| Smiles | ClC(c1c(CC2)cccc1)=C2/C=N\N(CC1)CCN1/N=C\C(CCc1c2cccc1)=C2Cl |
| InChI | InChI=1S/C26H26Cl2N4/c27-25-21(11-9-19-5-1-3-7-23(19)25)17-29-31-13-15-32(16-14-31)30-18-22-12-10-20-6-2-4-8-24(20)26(22)28/h1-8,17-18H,9-16H2 |
| InChIK | NLLWJUYFKKEIHI-UHFFFAOYSA-N |
| TotalMolweight | 465.426 |
| Molweight | 465.426 |
| MonoisotopicMass | 464.15345 |
| CLogP | 5.195 |
| CLogS | -3.058 |
| H Acceptors | 4 |
| TotalSurfaceArea | 349.4 |
| Relative PSA | 0.086205 |
| PolarSurfaceArea | 31.2 |
| Druglikeness | 4.4245 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | allyl/benzyl chloride; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(1-chloro-3,4-dihydronaphthalen-2-yl)-N-[4-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]piperazin-1-yl]methanimine | 2 - (Z)-1-(1-chloro-3,4-dihydronaphthalen-2-yl)-N-[4-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]piperazin-1-yl]methanimine