| MolName | 3-[(Z)-benzylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| MolecularFormula | C12H13N3O2S2 |
| Smiles | N=C1SC(CS(C2)(=O)=O)C2N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2S2/c13-12-15(14-6-9-4-2-1-3-5-9)10-7-19(16,17)8-11(10)18-12/h1-6,10-11,13H,7-8H2 |
| InChIK | NLODYMFSRNMWAW-UHFFFAOYSA-N |
| TotalMolweight | 295.386 |
| Molweight | 295.386 |
| MonoisotopicMass | 295.044917 |
| CLogP | 0.6498 |
| CLogS | -2.282 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 200.22 |
| Relative PSA | 0.38323 |
| PolarSurfaceArea | 107.27 |
| Druglikeness | 2.0487 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 2 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 3-[(Z)-benzylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine | 2 - 3-[(Z)-benzylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine