| MolName | [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C23H14N2O6Br2Cl2 |
| Smiles | O=C(COc(ccc(Cl)c1)c1Cl)N/N=C\c1cc(Br)cc(Br)c1OC(c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C23H14Br2Cl2N2O6/c24-14-5-13(9-28-29-21(30)10-32-18-4-2-15(26)8-17(18)27)22(16(25)7-14)35-23(31)12-1-3-19-20(6-12)34-11-33-19/h1-9H,10-11H2,(H,29,30) |
| InChIK | NLQWWTZGHYPHGN-UHFFFAOYSA-N |
| TotalMolweight | 645.086 |
| Molweight | 645.086 |
| MonoisotopicMass | 641.859564 |
| CLogP | 6.9808 |
| CLogS | -8.822 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 386.62 |
| Relative PSA | 0.23033 |
| PolarSurfaceArea | 95.45 |
| Druglikeness | 2.2014 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate