| MolName | 2-N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C26H23N8O2ClS |
| Smiles | [O-][N+](c(cc(/C=N\Nc1nc(N2CCCC2)nc(Nc2ccccc2)n1)cc1)c1Sc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C26H23ClN8O2S/c27-19-9-11-21(12-10-19)38-23-13-8-18(16-22(23)35(36)37)17-28-33-25-30-24(29-20-6-2-1-3-7-20)31-26(32-25)34-14-4-5-15-34/h1-3,6-13,16-17H,4-5,14-15H2,(H2,29,30,31,32,33) |
| InChIK | NLVCYUZVDYPDAN-UHFFFAOYSA-N |
| TotalMolweight | 547.042 |
| Molweight | 547.042 |
| MonoisotopicMass | 546.135319 |
| CLogP | 7.2782 |
| CLogS | -8.617 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 404.92 |
| Relative PSA | 0.29339 |
| PolarSurfaceArea | 149.45 |
| Druglikeness | -0.73038 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine