| MolName | 3-(2-chlorophenyl)-4-[(Z)-(2,4-dibromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H9N4OBr2ClS |
| Smiles | Oc(c(Br)ccc1/C=N\N(C(c(cccc2)c2Cl)=NN2)C2=S)c1Br |
| InChI | InChI=1S/C15H9Br2ClN4OS/c16-10-6-5-8(12(17)13(10)23)7-19-22-14(20-21-15(22)24)9-3-1-2-4-11(9)18/h1-7,23H,(H,21,24) |
| InChIK | NLXONKLELODHSI-UHFFFAOYSA-N |
| TotalMolweight | 488.59 |
| Molweight | 488.59 |
| MonoisotopicMass | 485.85523 |
| CLogP | 5.0057 |
| CLogS | -6.559 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 280.75 |
| Relative PSA | 0.28185 |
| PolarSurfaceArea | 92.31 |
| Druglikeness | 1.7456 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2-chlorophenyl)-4-[(Z)-(2,4-dibromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2-chlorophenyl)-4-[(Z)-(2,4-dibromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione