| MolName | 3-bromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide |
| MolecularFormula | C30H21N3OBr2 |
| Smiles | O=C(c1cccc(Br)c1)N/N=C\c(cc1-c2ccccc2)c(-c2ccccc2)n1-c(cc1)ccc1Br |
| InChI | InChI=1S/C30H21Br2N3O/c31-25-14-16-27(17-15-25)35-28(21-8-3-1-4-9-21)19-24(29(35)22-10-5-2-6-11-22)20-33-34-30(36)23-12-7-13-26(32)18-23/h1-20H,(H,34,36) |
| InChIK | NMEBKPHKGFZTOL-UHFFFAOYSA-N |
| TotalMolweight | 599.325 |
| Molweight | 599.325 |
| MonoisotopicMass | 597.005134 |
| CLogP | 8.3373 |
| CLogS | -11.258 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 392.73 |
| Relative PSA | 0.10918 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 3.7934 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.44444 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-bromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide | 2 - 3-bromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide