| MolName | 2-[2-[(Z)-[[2-(4-fluorophenyl)quinoline-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C25H17N3O4F |
| Smiles | [O-]C(COc1c(/C=N\NC(c2cc(-c(cc3)ccc3F)nc3ccccc23)=O)cccc1)=O |
| InChI | InChI=1S/C25H18FN3O4/c26-18-11-9-16(10-12-18)22-13-20(19-6-2-3-7-21(19)28-22)25(32)29-27-14-17-5-1-4-8-23(17)33-15-24(30)31/h1-14H,15H2,(H,29,32)(H,30,31)/p-1 |
| InChIK | NMGHZDUOEPNBPB-UHFFFAOYSA-M |
| TotalMolweight | 442.425 |
| Molweight | 442.425 |
| MonoisotopicMass | 442.12031 |
| CLogP | 2.3526 |
| CLogS | -6.312 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 335.5 |
| Relative PSA | 0.25127 |
| PolarSurfaceArea | 103.71 |
| Druglikeness | 2.9064 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-(4-fluorophenyl)quinoline-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[[2-(4-fluorophenyl)quinoline-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate