| MolName | (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(3-phenylmethoxyphenyl)methanimine |
| MolecularFormula | C25H26N3OCl |
| Smiles | Clc1ccc(CN(CC2)CCN2/N=C\c2cc(OCc3ccccc3)ccc2)cc1 |
| InChI | InChI=1S/C25H26ClN3O/c26-24-11-9-21(10-12-24)19-28-13-15-29(16-14-28)27-18-23-7-4-8-25(17-23)30-20-22-5-2-1-3-6-22/h1-12,17-18H,13-16,19-20H2 |
| InChIK | NMPXOIJGWMGCCV-UHFFFAOYSA-N |
| TotalMolweight | 419.954 |
| Molweight | 419.954 |
| MonoisotopicMass | 419.176439 |
| CLogP | 4.9731 |
| CLogS | -4.733 |
| H Acceptors | 4 |
| TotalSurfaceArea | 332.62 |
| Relative PSA | 0.086014 |
| PolarSurfaceArea | 28.07 |
| Druglikeness | 6.4082 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(3-phenylmethoxyphenyl)methanimine | 2 - (Z)-N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-(3-phenylmethoxyphenyl)methanimine