| MolName | [2-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C21H13N4O3ClS |
| Smiles | O=C(c(sc1c2cccc1)c2Cl)Oc1c(/C=N\NC(c2nccnc2)=O)cccc1 |
| InChI | InChI=1S/C21H13ClN4O3S/c22-18-14-6-2-4-8-17(14)30-19(18)21(28)29-16-7-3-1-5-13(16)11-25-26-20(27)15-12-23-9-10-24-15/h1-12H,(H,26,27) |
| InChIK | NNWUDYLEVANGDJ-UHFFFAOYSA-N |
| TotalMolweight | 436.878 |
| Molweight | 436.878 |
| MonoisotopicMass | 436.039688 |
| CLogP | 4.2115 |
| CLogS | -5.71 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 317.98 |
| Relative PSA | 0.31873 |
| PolarSurfaceArea | 121.78 |
| Druglikeness | 5.3724 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [2-[(Z)-(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate