| MolName | 2-[5-[(Z)-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| MolecularFormula | C21H15N6O4S |
| Smiles | [O-]C(c(cccc1)c1-c1ccc(/C=N\NC(CSc2nnnn2-c2ccccc2)=O)o1)=O |
| InChI | InChI=1S/C21H16N6O4S/c28-19(13-32-21-24-25-26-27(21)14-6-2-1-3-7-14)23-22-12-15-10-11-18(31-15)16-8-4-5-9-17(16)20(29)30/h1-12H,13H2,(H,23,28)(H,29,30)/p-1 |
| InChIK | NOEJXYIQBFBWOS-UHFFFAOYSA-M |
| TotalMolweight | 447.454 |
| Molweight | 447.454 |
| MonoisotopicMass | 447.087549 |
| CLogP | 0.9031 |
| CLogS | -5.804 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 338.21 |
| Relative PSA | 0.3983 |
| PolarSurfaceArea | 163.63 |
| Druglikeness | 5.6919 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[5-[(Z)-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate | 2 - 2-[5-[(Z)-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate