| MolName | N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C11H9N2O2BrS2 |
| Smiles | O=S(c1ccccc1)(N/N=C\c(s1)ccc1Br)=O |
| InChI | InChI=1S/C11H9BrN2O2S2/c12-11-7-6-9(17-11)8-13-14-18(15,16)10-4-2-1-3-5-10/h1-8,14H |
| InChIK | NOGOHCITAWHFLD-UHFFFAOYSA-N |
| TotalMolweight | 345.24 |
| Molweight | 345.24 |
| MonoisotopicMass | 343.928879 |
| CLogP | 3.0736 |
| CLogS | -2.777 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 212.39 |
| Relative PSA | 0.33858 |
| PolarSurfaceArea | 95.15 |
| Druglikeness | -7.0445 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]benzenesulfonamide