| MolName | (Z)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]fluoren-9-imine |
| MolecularFormula | C20H9N2F5 |
| Smiles | Fc(c(/C=N\N=C1c(cccc2)c2-c2c1cccc2)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C20H9F5N2/c21-15-14(16(22)18(24)19(25)17(15)23)9-26-27-20-12-7-3-1-5-10(12)11-6-2-4-8-13(11)20/h1-9H |
| InChIK | NOQRIWHCKUUTMO-UHFFFAOYSA-N |
| TotalMolweight | 372.295 |
| Molweight | 372.295 |
| MonoisotopicMass | 372.068588 |
| CLogP | 6.8726 |
| CLogS | -8.478 |
| H Acceptors | 2 |
| TotalSurfaceArea | 258.76 |
| Relative PSA | 0.088963 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 0.60187 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.48148 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]fluoren-9-imine | 2 - (Z)-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]fluoren-9-imine