| MolName | 4-N-(4-fluorophenyl)-6-piperidin-1-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C22H21N7F4 |
| Smiles | FC(c1c(/C=N\Nc2nc(Nc(cc3)ccc3F)nc(N3CCCCC3)n2)cccc1)(F)F |
| InChI | InChI=1S/C22H21F4N7/c23-16-8-10-17(11-9-16)28-19-29-20(31-21(30-19)33-12-4-1-5-13-33)32-27-14-15-6-2-3-7-18(15)22(24,25)26/h2-3,6-11,14H,1,4-5,12-13H2,(H2,28,29,30,31,32) |
| InChIK | NPEQJHISCIARSF-UHFFFAOYSA-N |
| TotalMolweight | 459.45 |
| Molweight | 459.45 |
| MonoisotopicMass | 459.179455 |
| CLogP | 7.575 |
| CLogS | -6.997 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 338.15 |
| Relative PSA | 0.20964 |
| PolarSurfaceArea | 78.33 |
| Druglikeness | -4.2222 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-fluorophenyl)-6-piperidin-1-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-fluorophenyl)-6-piperidin-1-yl-2-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine