| MolName | N,N'-bis[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]oxamide |
| MolecularFormula | C20H14N6O6Cl2 |
| Smiles | [O-][N+](c1ccc(/C=C(/C=N\NC(C(N/N=C\C(\Cl)=C\c(cc2)ccc2[N+]([O-])=O)=O)=O)\Cl)cc1)=O |
| InChI | InChI=1S/C20H14Cl2N6O6/c21-15(9-13-1-5-17(6-2-13)27(31)32)11-23-25-19(29)20(30)26-24-12-16(22)10-14-3-7-18(8-4-14)28(33)34/h1-12H,(H,25,29)(H,26,30) |
| InChIK | NPUXHQVKHMWTET-UHFFFAOYSA-N |
| TotalMolweight | 505.273 |
| Molweight | 505.273 |
| MonoisotopicMass | 504.035188 |
| CLogP | 1.655 |
| CLogS | -7.004 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 368.56 |
| Relative PSA | 0.36048 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | -1.5705 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 19 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]oxamide | 2 - N,N'-bis[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]oxamide