| MolName | 4-chloro-N-[(Z)-[4-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C21H13N4O4Cl |
| Smiles | N#Cc(cc(cc1)[N+]([O-])=O)c1Oc1ccc(/C=N\NC(c(cc2)ccc2Cl)=O)cc1 |
| InChI | InChI=1S/C21H13ClN4O4/c22-17-5-3-15(4-6-17)21(27)25-24-13-14-1-8-19(9-2-14)30-20-10-7-18(26(28)29)11-16(20)12-23/h1-11,13H,(H,25,27) |
| InChIK | NPXSPVCZHICCBR-UHFFFAOYSA-N |
| TotalMolweight | 420.811 |
| Molweight | 420.811 |
| MonoisotopicMass | 420.062533 |
| CLogP | 4.1172 |
| CLogS | -7.987 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 317.55 |
| Relative PSA | 0.28339 |
| PolarSurfaceArea | 120.3 |
| Druglikeness | -5.1074 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-[4-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-[4-(2-cyano-4-nitrophenoxy)phenyl]methylideneamino]benzamide