| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H11N3OClFS2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C\c(c(F)ccc1)c1Cl |
| InChI | InChI=1S/C16H11ClFN3OS2/c17-11-4-3-5-12(18)10(11)8-19-21-15(22)9-23-16-20-13-6-1-2-7-14(13)24-16/h1-8H,9H2,(H,21,22) |
| InChIK | NPZMTZPNSNQUHC-UHFFFAOYSA-N |
| TotalMolweight | 379.866 |
| Molweight | 379.866 |
| MonoisotopicMass | 379.001607 |
| CLogP | 4.6231 |
| CLogS | -6.149 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 269.31 |
| Relative PSA | 0.31499 |
| PolarSurfaceArea | 107.89 |
| Druglikeness | 3.4728 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]acetamide