| MolName | [2-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C21H14N3O6Br |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc1c(/C=N\NC(c(cc(cc2)Br)c2O)=O)cccc1)=O)=O |
| InChI | InChI=1S/C21H14BrN3O6/c22-15-7-10-18(26)17(11-15)20(27)24-23-12-14-3-1-2-4-19(14)31-21(28)13-5-8-16(9-6-13)25(29)30/h1-12,26H,(H,24,27) |
| InChIK | NQOKYSINMPQLAE-UHFFFAOYSA-N |
| TotalMolweight | 484.261 |
| Molweight | 484.261 |
| MonoisotopicMass | 483.006598 |
| CLogP | 4.09 |
| CLogS | -6.189 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 323.15 |
| Relative PSA | 0.31741 |
| PolarSurfaceArea | 133.81 |
| Druglikeness | -2.8674 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [2-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate