| MolName | 3-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C17H22N4O3S |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C17H22N4O3S/c22-15-17(6-2-1-3-7-17)19-16(23)21(15)18-12-13-4-5-14(25-13)20-8-10-24-11-9-20/h4-5,12H,1-3,6-11H2,(H,19,23) |
| InChIK | NQQGBRJUIPUUTF-UHFFFAOYSA-N |
| TotalMolweight | 362.453 |
| Molweight | 362.453 |
| MonoisotopicMass | 362.141261 |
| CLogP | 1.876 |
| CLogS | -3.999 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 265.27 |
| Relative PSA | 0.32612 |
| PolarSurfaceArea | 102.48 |
| Druglikeness | 2.9557 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione