| MolName | (Z)-1-(4-chlorophenyl)-N-morpholin-4-ylmethanimine |
| MolecularFormula | C11H13N2OCl |
| Smiles | Clc1ccc(/C=N\N2CCOCC2)cc1 |
| InChI | InChI=1S/C11H13ClN2O/c12-11-3-1-10(2-4-11)9-13-14-5-7-15-8-6-14/h1-4,9H,5-8H2 |
| InChIK | NQTWJUKJFISPNX-UHFFFAOYSA-N |
| TotalMolweight | 224.69 |
| Molweight | 224.69 |
| MonoisotopicMass | 224.07164 |
| CLogP | 2.0975 |
| CLogS | -2.567 |
| H Acceptors | 3 |
| TotalSurfaceArea | 175.28 |
| Relative PSA | 0.14297 |
| PolarSurfaceArea | 24.83 |
| Druglikeness | 2.8789 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.73333 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-chlorophenyl)-N-morpholin-4-ylmethanimine | 2 - (Z)-1-(4-chlorophenyl)-N-morpholin-4-ylmethanimine